C29H40N4O5 — CID 71667323
[(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[1-(azepan-1-ylamino)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 71667323) has the molecular formula C29H40N4O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[1-(azepan-1-ylamino)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[1-(azepan-1-ylamino)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71667323 |
| Molecular Formula | C29H40N4O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[1-(azepan-1-ylamino)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](O)C=CC4C(C2)N(C)CC[C@@]341)C(=O)NN1CCCCCC1 |
| InChI | InChI=1S/C29H40N4O5/c1-17(2)24(27(35)31-33-13-6-4-5-7-14-33)30-28(36)37-22-11-8-18-16-20-19-9-10-21(34)26-29(19,12-15-32(20)3)23(18)25(22)38-26/h8-11,17,19-21,24,26,34H,4-7,12-16H2,1-3H3,(H,30,36)(H,31,35)/t19?,20?,21-,24?,26-,29-/m0/s1 |
| InChIKey | SVDGMCSGSQYFDL-HEZZILNGSA-N |
| XLogP | 2.51 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|