C24H32Cl2N4O6 — CID 71667026
[(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-(morpholin-4-ylamino)-2-oxoethyl]carbamate;dihydrochloride (PubChem CID 71667026) has the molecular formula C24H32Cl2N4O6 and a molecular weight of 543.45 g/mol. Its IUPAC name is [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-(morpholin-4-ylamino)-2-oxoethyl]carbamate;dihydrochloride.
| Compound Name | [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-(morpholin-4-ylamino)-2-oxoethyl]carbamate;dihydrochloride |
|---|---|
| PubChem CID | 71667026 |
| Molecular Formula | C24H32Cl2N4O6 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | [(7S,7aR,12bS)-7-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-(morpholin-4-ylamino)-2-oxoethyl]carbamate;dihydrochloride |
| SMILES | CN1CC[C@]23c4c5ccc(OC(=O)NCC(=O)NN6CCOCC6)c4O[C@H]2[C@@H](O)C=CC3C1C5.Cl.Cl |
| InChI | InChI=1S/C24H30N4O6.2ClH/c1-27-7-6-24-15-3-4-17(29)22(24)34-21-18(5-2-14(20(21)24)12-16(15)27)33-23(31)25-13-19(30)26-28-8-10-32-11-9-28;;/h2-5,15-17,22,29H,6-13H2,1H3,(H,25,31)(H,26,30);2*1H/t15?,16?,17-,22-,24-;;/m0../s1 |
| InChIKey | AVNYQAMERMAFAH-XXYPDFDNSA-N |
| XLogP | 0.79 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|