C28H38N4O4 — CID 71668204
[(7aS,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[(2S)-2-methyl-4-oxo-4-(piperidin-1-ylamino)butyl]carbamate (PubChem CID 71668204) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is [(7aS,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[(2S)-2-methyl-4-oxo-4-(piperidin-1-ylamino)butyl]carbamate.
| Compound Name | [(7aS,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[(2S)-2-methyl-4-oxo-4-(piperidin-1-ylamino)butyl]carbamate |
|---|---|
| PubChem CID | 71668204 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [(7aS,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[(2S)-2-methyl-4-oxo-4-(piperidin-1-ylamino)butyl]carbamate |
| SMILES | C[C@H](CNC(=O)Oc1ccc2c3c1O[C@H]1CC=CC4C(C2)N(C)CC[C@@]341)CC(=O)NN1CCCCC1 |
| InChI | InChI=1S/C28H38N4O4/c1-18(15-24(33)30-32-12-4-3-5-13-32)17-29-27(34)35-22-10-9-19-16-21-20-7-6-8-23-28(20,11-14-31(21)2)25(19)26(22)36-23/h6-7,9-10,18,20-21,23H,3-5,8,11-17H2,1-2H3,(H,29,34)(H,30,33)/t18-,20?,21?,23-,28+/m0/s1 |
| InChIKey | AUPNBBCBXNHIOF-IOICSNARSA-N |
| XLogP | 3.15 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|