About 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane
1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane (PubChem CID 159933964) has the molecular formula C20H28S2
and a molecular weight of 332.58 g/mol. Its IUPAC name is 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane.
Molecular Properties
| Compound Name | 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane |
| PubChem CID | 159933964 |
| Molecular Formula | C20H28S2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane |
| SMILES | CCCSCCC.Cc1ccc(Sc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14S.C6H14S/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-3-5-7-6-4-2/h3-10H,1-2H3;3-6H2,1-2H3 |
| InChIKey | NZZPRVNLUANINV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane?
The IUPAC name of 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane (CID 159933964) is 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane.
What is the SMILES notation for 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane?
The canonical SMILES for 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane is CCCSCCC.Cc1ccc(Sc2ccc(C)cc2)cc1.
What is the InChIKey of 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane?
The InChIKey is NZZPRVNLUANINV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S.C6H14S/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;1-3-5-7-6-4-2/h3-10H,1-2H3;3-6H2,1-2H3.
What are the key properties of 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane?
1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane has a molecular weight of 332.58 g/mol, XLogP of 6.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(4-methylphenyl)sulfanylbenzene;1-propylsulfanylpropane is sourced from PubChem (CID 159933964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).