C25H28N3O3PS — CID 159934928
2-dimethylphosphoryl-4-[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[2,3-b]pyridin-5-yl]aniline (PubChem CID 159934928) has the molecular formula C25H28N3O3PS and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-dimethylphosphoryl-4-[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[2,3-b]pyridin-5-yl]aniline.
| Compound Name | 2-dimethylphosphoryl-4-[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[2,3-b]pyridin-5-yl]aniline |
|---|---|
| PubChem CID | 159934928 |
| Molecular Formula | C25H28N3O3PS |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-dimethylphosphoryl-4-[1-(4-methylphenyl)sulfonyl-3-propan-2-ylpyrrolo[2,3-b]pyridin-5-yl]aniline |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(C)C)c3cc(-c4ccc(N)c(P(C)(C)=O)c4)cnc32)cc1 |
| InChI | InChI=1S/C25H28N3O3PS/c1-16(2)22-15-28(33(30,31)20-9-6-17(3)7-10-20)25-21(22)12-19(14-27-25)18-8-11-23(26)24(13-18)32(4,5)29/h6-16H,26H2,1-5H3 |
| InChIKey | OACSVAYGDJYSSD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|