C31H30Cl2O6 — CID 159935730
dichloromethane;(5E)-5-(1-hydroxy-2-naphthalen-1-ylethylidene)-2,2-dimethyl-1,3-dioxan-4-one;2-naphthalen-1-ylacetic acid (PubChem CID 159935730) has the molecular formula C31H30Cl2O6 and a molecular weight of 569.48 g/mol. Its IUPAC name is dichloromethane;(5E)-5-(1-hydroxy-2-naphthalen-1-ylethylidene)-2,2-dimethyl-1,3-dioxan-4-one;2-naphthalen-1-ylacetic acid.
| Compound Name | dichloromethane;(5E)-5-(1-hydroxy-2-naphthalen-1-ylethylidene)-2,2-dimethyl-1,3-dioxan-4-one;2-naphthalen-1-ylacetic acid |
|---|---|
| PubChem CID | 159935730 |
| Molecular Formula | C31H30Cl2O6 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | dichloromethane;(5E)-5-(1-hydroxy-2-naphthalen-1-ylethylidene)-2,2-dimethyl-1,3-dioxan-4-one;2-naphthalen-1-ylacetic acid |
| SMILES | CC1(C)OC/C(=C(\O)Cc2cccc3ccccc23)C(=O)O1.ClCCl.O=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C18H18O4.C12H10O2.CH2Cl2/c1-18(2)21-11-15(17(20)22-18)16(19)10-13-8-5-7-12-6-3-4-9-14(12)13;13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;2-1-3/h3-9,19H,10-11H2,1-2H3;1-7H,8H2,(H,13,14);1H2/b16-15+;; |
| InChIKey | OAFOGXWXHFBEBI-VRZXRVJBSA-N |
| XLogP | 7.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|