C34H39N3O7 — CID 15993829
3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 15993829) has the molecular formula C34H39N3O7 and a molecular weight of 601.70 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 15993829 |
| Molecular Formula | C34H39N3O7 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-N-(2,3-dimethylcyclohexyl)-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)C2C3C=CC4(O3)C2C(=O)N(CC2COc3ccccc3O2)C4C(=O)NC2CCCC(C)C2C)cc1 |
| InChI | InChI=1S/C34H39N3O7/c1-19-7-6-8-24(20(19)2)36-32(39)30-34-16-15-27(44-34)28(31(38)35-21-11-13-22(41-3)14-12-21)29(34)33(40)37(30)17-23-18-42-25-9-4-5-10-26(25)43-23/h4-5,9-16,19-20,23-24,27-30H,6-8,17-18H2,1-3H3,(H,35,38)(H,36,39) |
| InChIKey | NQXWXYRJFXOJGZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|