About benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide
benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide (PubChem CID 159939573) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide |
| PubChem CID | 159939573 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide |
| SMILES | CN1CCOCC1.C[N+](C)(C)Cc1ccccc1.[OH-] |
| InChI | InChI=1S/C10H16N.C5H11NO.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;1-6-2-4-7-5-3-6;/h4-8H,9H2,1-3H3;2-5H2,1H3;1H2/q+1;;/p-1 |
| InChIKey | OARVTVKNWYFSES-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 42.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide?
The IUPAC name of benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide (CID 159939573) is benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide.
What is the SMILES notation for benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide?
The canonical SMILES for benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide is CN1CCOCC1.C[N+](C)(C)Cc1ccccc1.[OH-].
What is the InChIKey of benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide?
The InChIKey is OARVTVKNWYFSES-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N.C5H11NO.H2O/c1-11(2,3)9-10-7-5-4-6-8-10;1-6-2-4-7-5-3-6;/h4-8H,9H2,1-3H3;2-5H2,1H3;1H2/q+1;;/p-1.
What are the key properties of benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide?
benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide has a molecular weight of 268.40 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium;4-methylmorpholine;hydroxide is sourced from PubChem (CID 159939573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).