C15H12N2O3S — CID 159942183
3-isocyano-5-[(1S)-4-methylidene-2-oxocycloheptyl]thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 159942183) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-isocyano-5-[(1S)-4-methylidene-2-oxocycloheptyl]thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-isocyano-5-[(1S)-4-methylidene-2-oxocycloheptyl]thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 159942183 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-isocyano-5-[(1S)-4-methylidene-2-oxocycloheptyl]thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | [C-]#[N+]c1scc2c1C(=O)N([C@H]1CCCC(=C)CC1=O)C2=O |
| InChI | InChI=1S/C15H12N2O3S/c1-8-4-3-5-10(11(18)6-8)17-14(19)9-7-21-13(16-2)12(9)15(17)20/h7,10H,1,3-6H2/t10-/m0/s1 |
| InChIKey | XFLXWCDMRDYGDK-JTQLQIEISA-N |
| XLogP | 2.96 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|