C14H14N2O3S — CID 157384410
3-amino-5-(4-methylidene-2-oxocycloheptyl)thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 157384410) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-amino-5-(4-methylidene-2-oxocycloheptyl)thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-amino-5-(4-methylidene-2-oxocycloheptyl)thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 157384410 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-amino-5-(4-methylidene-2-oxocycloheptyl)thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | C=C1CCCC(N2C(=O)c3csc(N)c3C2=O)C(=O)C1 |
| InChI | InChI=1S/C14H14N2O3S/c1-7-3-2-4-9(10(17)5-7)16-13(18)8-6-20-12(15)11(8)14(16)19/h6,9H,1-5,15H2 |
| InChIKey | NNGAPFBTDFQLJD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|