C24H32N2O6 — CID 159946261
tert-butyl N-[4-[3-(10-hydroxy-9-oxodecanoyl)-1,2-oxazol-5-yl]phenyl]carbamate (PubChem CID 159946261) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(10-hydroxy-9-oxodecanoyl)-1,2-oxazol-5-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(10-hydroxy-9-oxodecanoyl)-1,2-oxazol-5-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 159946261 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | tert-butyl N-[4-[3-(10-hydroxy-9-oxodecanoyl)-1,2-oxazol-5-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cc(C(=O)CCCCCCCC(=O)CO)no2)cc1 |
| InChI | InChI=1S/C24H32N2O6/c1-24(2,3)31-23(30)25-18-13-11-17(12-14-18)22-15-20(26-32-22)21(29)10-8-6-4-5-7-9-19(28)16-27/h11-15,27H,4-10,16H2,1-3H3,(H,25,30) |
| InChIKey | OBNJIHONJQAVTO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|