C22H27NO4S — CID 161410208
tert-butyl N-[4-[5-(6-oxoheptanoyl)thiophen-3-yl]phenyl]carbamate (PubChem CID 161410208) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is tert-butyl N-[4-[5-(6-oxoheptanoyl)thiophen-3-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-(6-oxoheptanoyl)thiophen-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 161410208 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | tert-butyl N-[4-[5-(6-oxoheptanoyl)thiophen-3-yl]phenyl]carbamate |
| SMILES | CC(=O)CCCCC(=O)c1cc(-c2ccc(NC(=O)OC(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C22H27NO4S/c1-15(24)7-5-6-8-19(25)20-13-17(14-28-20)16-9-11-18(12-10-16)23-21(26)27-22(2,3)4/h9-14H,5-8H2,1-4H3,(H,23,26) |
| InChIKey | XKBGOKAEFWNCMQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|