C23H19Na2O8P — CID 159948337
disodium;[2-(furan-2-yl)-3-(3-methoxy-4,5-dimethylbenzoyl)-6-methyl-1-benzofuran-7-yl] phosphate (PubChem CID 159948337) has the molecular formula C23H19Na2O8P and a molecular weight of 500.35 g/mol. Its IUPAC name is disodium;[2-(furan-2-yl)-3-(3-methoxy-4,5-dimethylbenzoyl)-6-methyl-1-benzofuran-7-yl] phosphate.
| Compound Name | disodium;[2-(furan-2-yl)-3-(3-methoxy-4,5-dimethylbenzoyl)-6-methyl-1-benzofuran-7-yl] phosphate |
|---|---|
| PubChem CID | 159948337 |
| Molecular Formula | C23H19Na2O8P |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | disodium;[2-(furan-2-yl)-3-(3-methoxy-4,5-dimethylbenzoyl)-6-methyl-1-benzofuran-7-yl] phosphate |
| SMILES | COc1cc(C(=O)c2c(-c3ccco3)oc3c(OP(=O)([O-])[O-])c(C)ccc23)cc(C)c1C.[Na+].[Na+] |
| InChI | InChI=1S/C23H21O8P.2Na/c1-12-7-8-16-19(20(24)15-10-13(2)14(3)18(11-15)28-4)23(17-6-5-9-29-17)30-22(16)21(12)31-32(25,26)27;;/h5-11H,1-4H3,(H2,25,26,27);;/q;2*+1/p-2 |
| InChIKey | OBTWYAQJLGVHES-UHFFFAOYSA-L |
| XLogP | -1.93 |
| TPSA | 125.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|