C19H28FN5O5S — CID 159948771
(3R)-4-[4-(4-fluorophenyl)piperidin-1-yl]oxy-3-N-hydroxy-1-N,1-N-dimethylpiperazine-1,3-dicarboxamide;sulfur monoxide (PubChem CID 159948771) has the molecular formula C19H28FN5O5S and a molecular weight of 457.53 g/mol. Its IUPAC name is (3R)-4-[4-(4-fluorophenyl)piperidin-1-yl]oxy-3-N-hydroxy-1-N,1-N-dimethylpiperazine-1,3-dicarboxamide;sulfur monoxide.
| Compound Name | (3R)-4-[4-(4-fluorophenyl)piperidin-1-yl]oxy-3-N-hydroxy-1-N,1-N-dimethylpiperazine-1,3-dicarboxamide;sulfur monoxide |
|---|---|
| PubChem CID | 159948771 |
| Molecular Formula | C19H28FN5O5S |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (3R)-4-[4-(4-fluorophenyl)piperidin-1-yl]oxy-3-N-hydroxy-1-N,1-N-dimethylpiperazine-1,3-dicarboxamide;sulfur monoxide |
| SMILES | CN(C)C(=O)N1CCN(ON2CCC(c3ccc(F)cc3)CC2)[C@@H](C(=O)NO)C1.O=S |
| InChI | InChI=1S/C19H28FN5O4.OS/c1-22(2)19(27)23-11-12-25(17(13-23)18(26)21-28)29-24-9-7-15(8-10-24)14-3-5-16(20)6-4-14;1-2/h3-6,15,17,28H,7-13H2,1-2H3,(H,21,26);/t17-;/m1./s1 |
| InChIKey | OBVHAUGKNQTJEM-UNTBIKODSA-N |
| XLogP | 0.69 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|