C20H30FN5O7S2 — CID 18727150
(2R)-1-[4-(4-fluorophenyl)piperidin-1-yl]sulfonyl-N-hydroxy-4-morpholin-4-ylsulfonylpiperazine-2-carboxamide (PubChem CID 18727150) has the molecular formula C20H30FN5O7S2 and a molecular weight of 535.62 g/mol. Its IUPAC name is (2R)-1-[4-(4-fluorophenyl)piperidin-1-yl]sulfonyl-N-hydroxy-4-morpholin-4-ylsulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-1-[4-(4-fluorophenyl)piperidin-1-yl]sulfonyl-N-hydroxy-4-morpholin-4-ylsulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18727150 |
| Molecular Formula | C20H30FN5O7S2 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (2R)-1-[4-(4-fluorophenyl)piperidin-1-yl]sulfonyl-N-hydroxy-4-morpholin-4-ylsulfonylpiperazine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CN(S(=O)(=O)N2CCOCC2)CCN1S(=O)(=O)N1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H30FN5O7S2/c21-18-3-1-16(2-4-18)17-5-7-23(8-6-17)35(31,32)26-10-9-25(15-19(26)20(27)22-28)34(29,30)24-11-13-33-14-12-24/h1-4,17,19,28H,5-15H2,(H,22,27)/t19-/m1/s1 |
| InChIKey | NORUZOXLVJRPIK-LJQANCHMSA-N |
| XLogP | -0.68 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|