C18H24ClN5O6S — CID 22615577
4-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-3-N-hydroxypiperazine-1,3-dicarboxamide (PubChem CID 22615577) has the molecular formula C18H24ClN5O6S and a molecular weight of 473.94 g/mol. Its IUPAC name is 4-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-3-N-hydroxypiperazine-1,3-dicarboxamide.
| Compound Name | 4-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-3-N-hydroxypiperazine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 22615577 |
| Molecular Formula | C18H24ClN5O6S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 4-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-3-N-hydroxypiperazine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CCN(S(=O)(=O)N2CCC(C(=O)c3ccc(Cl)cc3)CC2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C18H24ClN5O6S/c19-14-3-1-12(2-4-14)16(25)13-5-7-23(8-6-13)31(29,30)24-10-9-22(18(20)27)11-15(24)17(26)21-28/h1-4,13,15,28H,5-11H2,(H2,20,27)(H,21,26) |
| InChIKey | ZZLWUOCMYZABGK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|