C18H23ClN4O6S — CID 57145851
(2R)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-4-formyl-N-hydroxypiperazine-2-carboxamide (PubChem CID 57145851) has the molecular formula C18H23ClN4O6S and a molecular weight of 458.92 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-4-formyl-N-hydroxypiperazine-2-carboxamide.
| Compound Name | (2R)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-4-formyl-N-hydroxypiperazine-2-carboxamide |
|---|---|
| PubChem CID | 57145851 |
| Molecular Formula | C18H23ClN4O6S |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (2R)-1-[4-(4-chlorobenzoyl)piperidin-1-yl]sulfonyl-4-formyl-N-hydroxypiperazine-2-carboxamide |
| SMILES | O=CN1CCN(S(=O)(=O)N2CCC(C(=O)c3ccc(Cl)cc3)CC2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C18H23ClN4O6S/c19-15-3-1-13(2-4-15)17(25)14-5-7-22(8-6-14)30(28,29)23-10-9-21(12-24)11-16(23)18(26)20-27/h1-4,12,14,16,27H,5-11H2,(H,20,26)/t16-/m1/s1 |
| InChIKey | DTUWTMSHQXXDCI-MRXNPFEDSA-N |
| XLogP | 0.13 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|