C16H23ClN4O5S — CID 22615791
1-[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonyl-N-hydroxypiperidine-2-carboxamide (PubChem CID 22615791) has the molecular formula C16H23ClN4O5S and a molecular weight of 418.90 g/mol. Its IUPAC name is 1-[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonyl-N-hydroxypiperidine-2-carboxamide.
| Compound Name | 1-[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonyl-N-hydroxypiperidine-2-carboxamide |
|---|---|
| PubChem CID | 22615791 |
| Molecular Formula | C16H23ClN4O5S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-[4-[(5-chloro-2-pyridinyl)oxy]piperidin-1-yl]sulfonyl-N-hydroxypiperidine-2-carboxamide |
| SMILES | O=C(NO)C1CCCCN1S(=O)(=O)N1CCC(Oc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C16H23ClN4O5S/c17-12-4-5-15(18-11-12)26-13-6-9-20(10-7-13)27(24,25)21-8-2-1-3-14(21)16(22)19-23/h4-5,11,13-14,23H,1-3,6-10H2,(H,19,22) |
| InChIKey | PJUKANOMPKVIBK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|