C16H24N4O4S2 — CID 18727157
(2R)-N-hydroxy-1-(4-pyridin-4-ylsulfanylpiperidin-1-yl)sulfonylpiperidine-2-carboxamide (PubChem CID 18727157) has the molecular formula C16H24N4O4S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is (2R)-N-hydroxy-1-(4-pyridin-4-ylsulfanylpiperidin-1-yl)sulfonylpiperidine-2-carboxamide.
| Compound Name | (2R)-N-hydroxy-1-(4-pyridin-4-ylsulfanylpiperidin-1-yl)sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 18727157 |
| Molecular Formula | C16H24N4O4S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (2R)-N-hydroxy-1-(4-pyridin-4-ylsulfanylpiperidin-1-yl)sulfonylpiperidine-2-carboxamide |
| SMILES | O=C(NO)[C@H]1CCCCN1S(=O)(=O)N1CCC(Sc2ccncc2)CC1 |
| InChI | InChI=1S/C16H24N4O4S2/c21-16(18-22)15-3-1-2-10-20(15)26(23,24)19-11-6-14(7-12-19)25-13-4-8-17-9-5-13/h4-5,8-9,14-15,22H,1-3,6-7,10-12H2,(H,18,21)/t15-/m1/s1 |
| InChIKey | UWGPYFXKUBVUAJ-OAHLLOKOSA-N |
| XLogP | 1.24 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|