C22H37ClN4O4SSi — CID 22615606
N-[tert-butyl(dimethyl)silyl]oxy-1-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylpiperidine-2-carboxamide (PubChem CID 22615606) has the molecular formula C22H37ClN4O4SSi and a molecular weight of 517.17 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]oxy-1-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylpiperidine-2-carboxamide.
| Compound Name | N-[tert-butyl(dimethyl)silyl]oxy-1-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 22615606 |
| Molecular Formula | C22H37ClN4O4SSi |
| Molecular Weight | 517.17 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]oxy-1-[4-(4-chlorophenyl)piperazin-1-yl]sulfonylpiperidine-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)ONC(=O)C1CCCCN1S(=O)(=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H37ClN4O4SSi/c1-22(2,3)33(4,5)31-24-21(28)20-8-6-7-13-27(20)32(29,30)26-16-14-25(15-17-26)19-11-9-18(23)10-12-19/h9-12,20H,6-8,13-17H2,1-5H3,(H,24,28) |
| InChIKey | SHYZIYOXWYYERV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|