C22H32ClN3O3SSi — CID 155632621
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-1-(4-chlorophenyl)piperidine-4-sulfonamide (PubChem CID 155632621) has the molecular formula C22H32ClN3O3SSi and a molecular weight of 482.12 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-1-(4-chlorophenyl)piperidine-4-sulfonamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-1-(4-chlorophenyl)piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 155632621 |
| Molecular Formula | C22H32ClN3O3SSi |
| Molecular Weight | 482.12 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-1-(4-chlorophenyl)piperidine-4-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NS(=O)(=O)C2CCN(c3ccc(Cl)cc3)CC2)nc1 |
| InChI | InChI=1S/C22H32ClN3O3SSi/c1-22(2,3)31(4,5)29-19-10-11-21(24-16-19)25-30(27,28)20-12-14-26(15-13-20)18-8-6-17(23)7-9-18/h6-11,16,20H,12-15H2,1-5H3,(H,24,25) |
| InChIKey | XHCMFSLCALHTDG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.12 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|