C22H31FN4O2Si — CID 155632677
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-fluorophenyl)piperazine-1-carboxamide (PubChem CID 155632677) has the molecular formula C22H31FN4O2Si and a molecular weight of 430.60 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 155632677 |
| Molecular Formula | C22H31FN4O2Si |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-fluorophenyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)N2CCN(c3ccc(F)cc3)CC2)nc1 |
| InChI | InChI=1S/C22H31FN4O2Si/c1-22(2,3)30(4,5)29-19-10-11-20(24-16-19)25-21(28)27-14-12-26(13-15-27)18-8-6-17(23)7-9-18/h6-11,16H,12-15H2,1-5H3,(H,24,25,28) |
| InChIKey | RJQPTOULWITKIB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|