C21H31N5O2Si — CID 155632598
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-pyridin-3-ylpiperazine-1-carboxamide (PubChem CID 155632598) has the molecular formula C21H31N5O2Si and a molecular weight of 413.60 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-pyridin-3-ylpiperazine-1-carboxamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-pyridin-3-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 155632598 |
| Molecular Formula | C21H31N5O2Si |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-pyridin-3-ylpiperazine-1-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)N2CCN(c3cccnc3)CC2)nc1 |
| InChI | InChI=1S/C21H31N5O2Si/c1-21(2,3)29(4,5)28-18-8-9-19(23-16-18)24-20(27)26-13-11-25(12-14-26)17-7-6-10-22-15-17/h6-10,15-16H,11-14H2,1-5H3,(H,23,24,27) |
| InChIKey | PEMYCWPUMNSCOS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|