C24H36N4O2Si — CID 159381922
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide (PubChem CID 159381922) has the molecular formula C24H36N4O2Si and a molecular weight of 440.66 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 159381922 |
| Molecular Formula | C24H36N4O2Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(N2CCN(CC(=O)Nc3ccc(O[Si](C)(C)C(C)(C)C)cn3)CC2)cc1 |
| InChI | InChI=1S/C24H36N4O2Si/c1-19-7-9-20(10-8-19)28-15-13-27(14-16-28)18-23(29)26-22-12-11-21(17-25-22)30-31(5,6)24(2,3)4/h7-12,17H,13-16,18H2,1-6H3,(H,25,26,29) |
| InChIKey | UVITVMAJCLXVHN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|