C23H33FN4O2Si — CID 151857612
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide (PubChem CID 151857612) has the molecular formula C23H33FN4O2Si and a molecular weight of 444.63 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 151857612 |
| Molecular Formula | C23H33FN4O2Si |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-[(4-fluorophenyl)methyl]piperazine-1-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)N2CCN(Cc3ccc(F)cc3)CC2)nc1 |
| InChI | InChI=1S/C23H33FN4O2Si/c1-23(2,3)31(4,5)30-20-10-11-21(25-16-20)26-22(29)28-14-12-27(13-15-28)17-18-6-8-19(24)9-7-18/h6-11,16H,12-15,17H2,1-5H3,(H,25,26,29) |
| InChIKey | SKADSVOAIZJVJE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|