C23H31N5O2Si — CID 155632630
N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-cyanophenyl)piperazine-1-carboxamide (PubChem CID 155632630) has the molecular formula C23H31N5O2Si and a molecular weight of 437.62 g/mol. Its IUPAC name is N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-cyanophenyl)piperazine-1-carboxamide.
| Compound Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-cyanophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 155632630 |
| Molecular Formula | C23H31N5O2Si |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-4-(4-cyanophenyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)N2CCN(c3ccc(C#N)cc3)CC2)nc1 |
| InChI | InChI=1S/C23H31N5O2Si/c1-23(2,3)31(4,5)30-20-10-11-21(25-17-20)26-22(29)28-14-12-27(13-15-28)19-8-6-18(16-24)7-9-19/h6-11,17H,12-15H2,1-5H3,(H,25,26,29) |
| InChIKey | WSKJCGWMGAQKEB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|