C10H24ClN5O3 — CID 159949858
2-chloro-N,N-dimethylethanamine;N,N-dimethylnitrous amide;N-methyl-N-nitrosopropanamide (PubChem CID 159949858) has the molecular formula C10H24ClN5O3 and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylethanamine;N,N-dimethylnitrous amide;N-methyl-N-nitrosopropanamide.
| Compound Name | 2-chloro-N,N-dimethylethanamine;N,N-dimethylnitrous amide;N-methyl-N-nitrosopropanamide |
|---|---|
| PubChem CID | 159949858 |
| Molecular Formula | C10H24ClN5O3 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-chloro-N,N-dimethylethanamine;N,N-dimethylnitrous amide;N-methyl-N-nitrosopropanamide |
| SMILES | CCC(=O)N(C)N=O.CN(C)CCCl.CN(C)N=O |
| InChI | InChI=1S/C4H10ClN.C4H8N2O2.C2H6N2O/c1-6(2)4-3-5;1-3-4(7)6(2)5-8;1-4(2)3-5/h3-4H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | OBYTXWLZKYMLMX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|