C43H64OPSe — CID 159951518
CID 159951518 (PubChem CID 159951518) has the molecular formula C43H64OPSe and a molecular weight of 706.92 g/mol.
| Compound Name | CID 159951518 |
|---|---|
| PubChem CID | 159951518 |
| Molecular Formula | C43H64OPSe |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 707.39 |
| IUPAC Name | — |
| SMILES | [H][Se]=P(c1ccccc1)(c1ccccc1)C(C)CCO[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(C(C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C43H64OPSe/c1-31(2)14-13-15-32(3)39-22-23-40-38-21-20-34-30-35(24-27-42(34,5)41(38)25-28-43(39,40)6)44-29-26-33(4)45(46,36-16-9-7-10-17-36)37-18-11-8-12-19-37/h7-12,16-20,31-33,35,38-41,46H,13-15,21-30H2,1-6H3/t32?,33?,35-,38-,39?,40-,41-,42-,43+/m0/s1 |
| InChIKey | OPZQMNOXHFYDBG-LZKHXRJWSA-N |
| XLogP | 10.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|