C26H29BrF2N4O4 — CID 159953143
N-(3-acetyl-4-fluorophenyl)pyrrolidine-1-carboxamide;N-[3-(2-bromoacetyl)-4-fluorophenyl]pyrrolidine-1-carboxamide (PubChem CID 159953143) has the molecular formula C26H29BrF2N4O4 and a molecular weight of 579.44 g/mol. Its IUPAC name is N-(3-acetyl-4-fluorophenyl)pyrrolidine-1-carboxamide;N-[3-(2-bromoacetyl)-4-fluorophenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-(3-acetyl-4-fluorophenyl)pyrrolidine-1-carboxamide;N-[3-(2-bromoacetyl)-4-fluorophenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 159953143 |
| Molecular Formula | C26H29BrF2N4O4 |
| Molecular Weight | 579.44 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | N-(3-acetyl-4-fluorophenyl)pyrrolidine-1-carboxamide;N-[3-(2-bromoacetyl)-4-fluorophenyl]pyrrolidine-1-carboxamide |
| SMILES | CC(=O)c1cc(NC(=O)N2CCCC2)ccc1F.O=C(CBr)c1cc(NC(=O)N2CCCC2)ccc1F |
| InChI | InChI=1S/C13H14BrFN2O2.C13H15FN2O2/c14-8-12(18)10-7-9(3-4-11(10)15)16-13(19)17-5-1-2-6-17;1-9(17)11-8-10(4-5-12(11)14)15-13(18)16-6-2-3-7-16/h3-4,7H,1-2,5-6,8H2,(H,16,19);4-5,8H,2-3,6-7H2,1H3,(H,15,18) |
| InChIKey | OCJGYLYSAWFBDV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|