C33H36N6O8 — CID 159954542
tert-butyl (3S)-3-[4-[(3-carbamoyl-2-nitrophenyl)methylideneamino]phenyl]piperidine-1-carboxylate;3-ethenyl-2-nitrobenzamide (PubChem CID 159954542) has the molecular formula C33H36N6O8 and a molecular weight of 644.69 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-[(3-carbamoyl-2-nitrophenyl)methylideneamino]phenyl]piperidine-1-carboxylate;3-ethenyl-2-nitrobenzamide.
| Compound Name | tert-butyl (3S)-3-[4-[(3-carbamoyl-2-nitrophenyl)methylideneamino]phenyl]piperidine-1-carboxylate;3-ethenyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 159954542 |
| Molecular Formula | C33H36N6O8 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | tert-butyl (3S)-3-[4-[(3-carbamoyl-2-nitrophenyl)methylideneamino]phenyl]piperidine-1-carboxylate;3-ethenyl-2-nitrobenzamide |
| SMILES | C=Cc1cccc(C(N)=O)c1[N+](=O)[O-].CC(C)(C)OC(=O)N1CCC[C@@H](c2ccc(/N=C/c3cccc(C(N)=O)c3[N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H28N4O5.C9H8N2O3/c1-24(2,3)33-23(30)27-13-5-7-18(15-27)16-9-11-19(12-10-16)26-14-17-6-4-8-20(22(25)29)21(17)28(31)32;1-2-6-4-3-5-7(9(10)12)8(6)11(13)14/h4,6,8-12,14,18H,5,7,13,15H2,1-3H3,(H2,25,29);2-5H,1H2,(H2,10,12)/b26-14+;/t18-;/m1./s1 |
| InChIKey | OCNUSCFQFYDABV-MODMILIXSA-N |
| XLogP | 5.90 |
| TPSA | 214.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|