C24H30N4O5 — CID 175563817
tert-butyl 3-[4-[(3-carbamoyl-2-nitrophenyl)methylamino]phenyl]piperidine-1-carboxylate (PubChem CID 175563817) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is tert-butyl 3-[4-[(3-carbamoyl-2-nitrophenyl)methylamino]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[(3-carbamoyl-2-nitrophenyl)methylamino]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175563817 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | tert-butyl 3-[4-[(3-carbamoyl-2-nitrophenyl)methylamino]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc(NCc3cccc(C(N)=O)c3[N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C24H30N4O5/c1-24(2,3)33-23(30)27-13-5-7-18(15-27)16-9-11-19(12-10-16)26-14-17-6-4-8-20(22(25)29)21(17)28(31)32/h4,6,8-12,18,26H,5,7,13-15H2,1-3H3,(H2,25,29) |
| InChIKey | FVQVVMMEXHYJOY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|