C28H28N2O5 — CID 15995827
N-(2-ethoxyphenyl)-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 15995827) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | N-(2-ethoxyphenyl)-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 15995827 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-(2-ethoxyphenyl)-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1c2cc(OC)c(OC)cc2C(=O)N2CCc3ccccc3C12 |
| InChI | InChI=1S/C28H28N2O5/c1-4-35-22-12-8-7-11-21(22)29-27(31)25-19-15-23(33-2)24(34-3)16-20(19)28(32)30-14-13-17-9-5-6-10-18(17)26(25)30/h5-12,15-16,25-26H,4,13-14H2,1-3H3,(H,29,31) |
| InChIKey | PJHNRJZOUKLFFO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |