C19H27N3O — CID 159958389
6-cyclopenta-2,4-dien-1-ylidene-3-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexa-2,4-dien-1-amine (PubChem CID 159958389) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 6-cyclopenta-2,4-dien-1-ylidene-3-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexa-2,4-dien-1-amine.
| Compound Name | 6-cyclopenta-2,4-dien-1-ylidene-3-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 159958389 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 6-cyclopenta-2,4-dien-1-ylidene-3-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexa-2,4-dien-1-amine |
| SMILES | CN1CCN(CCCOC2=CC(N)C(=C3C=CC=C3)C=C2)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-21-10-12-22(13-11-21)9-4-14-23-17-7-8-18(19(20)15-17)16-5-2-3-6-16/h2-3,5-8,15,19H,4,9-14,20H2,1H3 |
| InChIKey | GDZOCXNXQDSCCN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|