C35H30N2O3 — CID 159962470
(1S,8R,9R)-6-methoxy-13,15-dimethyl-9-(4-methylphenyl)-4,8-diphenyl-10-oxa-3,5-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaen-1-ol (PubChem CID 159962470) has the molecular formula C35H30N2O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is (1S,8R,9R)-6-methoxy-13,15-dimethyl-9-(4-methylphenyl)-4,8-diphenyl-10-oxa-3,5-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaen-1-ol.
| Compound Name | (1S,8R,9R)-6-methoxy-13,15-dimethyl-9-(4-methylphenyl)-4,8-diphenyl-10-oxa-3,5-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaen-1-ol |
|---|---|
| PubChem CID | 159962470 |
| Molecular Formula | C35H30N2O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | (1S,8R,9R)-6-methoxy-13,15-dimethyl-9-(4-methylphenyl)-4,8-diphenyl-10-oxa-3,5-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaen-1-ol |
| SMILES | COc1nc(-c2ccccc2)nc2c1[C@@H](c1ccccc1)[C@]1(c3ccc(C)cc3)Oc3cc(C)cc(C)c3[C@]21O |
| InChI | InChI=1S/C35H30N2O3/c1-21-15-17-26(18-16-21)35-30(24-11-7-5-8-12-24)28-31(34(35,38)29-23(3)19-22(2)20-27(29)40-35)36-32(37-33(28)39-4)25-13-9-6-10-14-25/h5-20,30,38H,1-4H3/t30-,34+,35+/m1/s1 |
| InChIKey | LTCNCKAIIWQNLH-DCCHFUKUSA-N |
| XLogP | 6.75 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |