C15H31N — CID 159964580
N,N-ditert-butyl-4,4-dimethylpent-1-en-2-amine (PubChem CID 159964580) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is N,N-ditert-butyl-4,4-dimethylpent-1-en-2-amine.
| Compound Name | N,N-ditert-butyl-4,4-dimethylpent-1-en-2-amine |
|---|---|
| PubChem CID | 159964580 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N,N-ditert-butyl-4,4-dimethylpent-1-en-2-amine |
| SMILES | C=C(CC(C)(C)C)N(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31N/c1-12(11-13(2,3)4)16(14(5,6)7)15(8,9)10/h1,11H2,2-10H3 |
| InChIKey | ODTOKBLPXTUGQA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |