C17H11F2N3O4 — CID 159968381
6-fluoro-1H-indole-2,3-dione;methyl 6-fluoro-1H-indazole-3-carboxylate (PubChem CID 159968381) has the molecular formula C17H11F2N3O4 and a molecular weight of 359.29 g/mol. Its IUPAC name is 6-fluoro-1H-indole-2,3-dione;methyl 6-fluoro-1H-indazole-3-carboxylate.
| Compound Name | 6-fluoro-1H-indole-2,3-dione;methyl 6-fluoro-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 159968381 |
| Molecular Formula | C17H11F2N3O4 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 6-fluoro-1H-indole-2,3-dione;methyl 6-fluoro-1H-indazole-3-carboxylate |
| SMILES | COC(=O)c1n[nH]c2cc(F)ccc12.O=C1Nc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C9H7FN2O2.C8H4FNO2/c1-14-9(13)8-6-3-2-5(10)4-7(6)11-12-8;9-4-1-2-5-6(3-4)10-8(12)7(5)11/h2-4H,1H3,(H,11,12);1-3H,(H,10,11,12) |
| InChIKey | OEFQANQONNATSJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|