C19H23Cl2FN2O2 — CID 159969792
CID 159969792 (PubChem CID 159969792) has the molecular formula C19H23Cl2FN2O2 and a molecular weight of 403.32 g/mol.
| Compound Name | CID 159969792 |
|---|---|
| PubChem CID | 159969792 |
| Molecular Formula | C19H23Cl2FN2O2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | — |
| SMILES | C.CNC(=O)c1cc(C2CN(C)Cc3c(Cl)cc(Cl)cc32)ccc1O.[3H]F |
| InChI | InChI=1S/C18H18Cl2N2O2.CH4.FH/c1-21-18(24)13-5-10(3-4-17(13)23)14-8-22(2)9-15-12(14)6-11(19)7-16(15)20;;/h3-7,14,23H,8-9H2,1-2H3,(H,21,24);1H4;1H/i/hT |
| InChIKey | OEKAAONVYIZSSW-MNYXATJNSA-N |
| XLogP | 4.42 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |