C17H18Cl2N2O2S2 — CID 138593305
4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-methylsulfanylbenzenesulfonamide (PubChem CID 138593305) has the molecular formula C17H18Cl2N2O2S2 and a molecular weight of 417.38 g/mol. Its IUPAC name is 4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-methylsulfanylbenzenesulfonamide.
| Compound Name | 4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-methylsulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 138593305 |
| Molecular Formula | C17H18Cl2N2O2S2 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-methylsulfanylbenzenesulfonamide |
| SMILES | CSNS(=O)(=O)c1ccc(C2CN(C)Cc3c(Cl)cc(Cl)cc32)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O2S2/c1-21-9-15(14-7-12(18)8-17(19)16(14)10-21)11-3-5-13(6-4-11)25(22,23)20-24-2/h3-8,15,20H,9-10H2,1-2H3 |
| InChIKey | IWGNOJHWGYGGOV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|