C19H22Cl2N2O5S2 — CID 89051623
3-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]propane-1-sulfonic acid (PubChem CID 89051623) has the molecular formula C19H22Cl2N2O5S2 and a molecular weight of 493.43 g/mol. Its IUPAC name is 3-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]propane-1-sulfonic acid.
| Compound Name | 3-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89051623 |
| Molecular Formula | C19H22Cl2N2O5S2 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 3-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]propane-1-sulfonic acid |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccc(S(=O)(=O)NCCCS(=O)(=O)O)cc2)C1 |
| InChI | InChI=1S/C19H22Cl2N2O5S2/c1-23-11-17(16-9-14(20)10-19(21)18(16)12-23)13-3-5-15(6-4-13)30(27,28)22-7-2-8-29(24,25)26/h3-6,9-10,17,22H,2,7-8,11-12H2,1H3,(H,24,25,26) |
| InChIKey | PMOLWHROYQLPTF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|