C22H28Cl2N2O4S — CID 70912751
4-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]-N-[2-(2-ethoxyethoxy)ethyl]benzenesulfonamide (PubChem CID 70912751) has the molecular formula C22H28Cl2N2O4S and a molecular weight of 487.45 g/mol. Its IUPAC name is 4-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]-N-[2-(2-ethoxyethoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]-N-[2-(2-ethoxyethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70912751 |
| Molecular Formula | C22H28Cl2N2O4S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 4-[(4R)-6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl]-N-[2-(2-ethoxyethoxy)ethyl]benzenesulfonamide |
| SMILES | CCOCCOCCNS(=O)(=O)c1ccc([C@H]2CN(C)Cc3c(Cl)cc(Cl)cc32)cc1 |
| InChI | InChI=1S/C22H28Cl2N2O4S/c1-3-29-10-11-30-9-8-25-31(27,28)18-6-4-16(5-7-18)20-14-26(2)15-21-19(20)12-17(23)13-22(21)24/h4-7,12-13,20,25H,3,8-11,14-15H2,1-2H3/t20-/m1/s1 |
| InChIKey | IFVMIXQGPBSFMK-HXUWFJFHSA-N |
| XLogP | 3.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|