C46H56Cl4N6O10S2 — CID 89051571
N,N'-bis[2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethoxy]ethyl]oxamide (PubChem CID 89051571) has the molecular formula C46H56Cl4N6O10S2 and a molecular weight of 1058.93 g/mol. Its IUPAC name is N,N'-bis[2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethoxy]ethyl]oxamide.
| Compound Name | N,N'-bis[2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethoxy]ethyl]oxamide |
|---|---|
| PubChem CID | 89051571 |
| Molecular Formula | C46H56Cl4N6O10S2 |
| Molecular Weight | 1058.93 g/mol |
| Exact Mass | 1056.23 |
| IUPAC Name | N,N'-bis[2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethoxy]ethyl]oxamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccc(S(=O)(=O)NCCOCCOCCNC(=O)C(=O)NCCOCCOCCNS(=O)(=O)c3ccc(C4CN(C)Cc5c(Cl)cc(Cl)cc54)cc3)cc2)C1 |
| InChI | InChI=1S/C46H56Cl4N6O10S2/c1-55-27-39(37-23-33(47)25-43(49)41(37)29-55)31-3-7-35(8-4-31)67(59,60)53-13-17-65-21-19-63-15-11-51-45(57)46(58)52-12-16-64-20-22-66-18-14-54-68(61,62)36-9-5-32(6-10-36)40-28-56(2)30-42-38(40)24-34(48)26-44(42)50/h3-10,23-26,39-40,53-54H,11-22,27-30H2,1-2H3,(H,51,57)(H,52,58) |
| InChIKey | PNQBISQEUAHSEQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 193.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.93 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|