C23H28Cl2N4O6S — CID 157335846
2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethyl]-2-hydroxypropanediamide (PubChem CID 157335846) has the molecular formula C23H28Cl2N4O6S and a molecular weight of 559.47 g/mol. Its IUPAC name is 2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethyl]-2-hydroxypropanediamide.
| Compound Name | 2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethyl]-2-hydroxypropanediamide |
|---|---|
| PubChem CID | 157335846 |
| Molecular Formula | C23H28Cl2N4O6S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 2-[2-[2-[[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]sulfonylamino]ethoxy]ethyl]-2-hydroxypropanediamide |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccc(S(=O)(=O)NCCOCCC(O)(C(N)=O)C(N)=O)cc2)C1 |
| InChI | InChI=1S/C23H28Cl2N4O6S/c1-29-12-18(17-10-15(24)11-20(25)19(17)13-29)14-2-4-16(5-3-14)36(33,34)28-7-9-35-8-6-23(32,21(26)30)22(27)31/h2-5,10-11,18,28,32H,6-9,12-13H2,1H3,(H2,26,30)(H2,27,31) |
| InChIKey | BFVDVVTZNWPPMJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|