C19H23Cl2IN2O2S — CID 158219395
N-[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]ethanesulfonamide;iodomethane (PubChem CID 158219395) has the molecular formula C19H23Cl2IN2O2S and a molecular weight of 541.28 g/mol. Its IUPAC name is N-[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]ethanesulfonamide;iodomethane.
| Compound Name | N-[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]ethanesulfonamide;iodomethane |
|---|---|
| PubChem CID | 158219395 |
| Molecular Formula | C19H23Cl2IN2O2S |
| Molecular Weight | 541.28 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | N-[4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]ethanesulfonamide;iodomethane |
| SMILES | CCS(=O)(=O)Nc1ccc(C2CN(C)Cc3c(Cl)cc(Cl)cc32)cc1.CI |
| InChI | InChI=1S/C18H20Cl2N2O2S.CH3I/c1-3-25(23,24)21-14-6-4-12(5-7-14)16-10-22(2)11-17-15(16)8-13(19)9-18(17)20;1-2/h4-9,16,21H,3,10-11H2,1-2H3;1H3 |
| InChIKey | GDBDYRBLVUYDMW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|