C19H23Cl2N4O4PS — CID 91366058
6,8-dichloro-4-[4-[[2-[(hydroxyamino)-methylphosphoryl]ethylideneamino]sulfonylamino]phenyl]-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 91366058) has the molecular formula C19H23Cl2N4O4PS and a molecular weight of 505.36 g/mol. Its IUPAC name is 6,8-dichloro-4-[4-[[2-[(hydroxyamino)-methylphosphoryl]ethylideneamino]sulfonylamino]phenyl]-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,8-dichloro-4-[4-[[2-[(hydroxyamino)-methylphosphoryl]ethylideneamino]sulfonylamino]phenyl]-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 91366058 |
| Molecular Formula | C19H23Cl2N4O4PS |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 6,8-dichloro-4-[4-[[2-[(hydroxyamino)-methylphosphoryl]ethylideneamino]sulfonylamino]phenyl]-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccc(NS(=O)(=O)N=CCP(C)(=O)NO)cc2)C1 |
| InChI | InChI=1S/C19H23Cl2N4O4PS/c1-25-11-17(16-9-14(20)10-19(21)18(16)12-25)13-3-5-15(6-4-13)23-31(28,29)22-7-8-30(2,27)24-26/h3-7,9-10,17,23,26H,8,11-12H2,1-2H3,(H,24,27) |
| InChIKey | HGLZRWMYBWRXPF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|