C18H22Cl2N4O2S — CID 68886429
4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-(dimethylaminosulfamoyl)aniline (PubChem CID 68886429) has the molecular formula C18H22Cl2N4O2S and a molecular weight of 429.37 g/mol. Its IUPAC name is 4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-(dimethylaminosulfamoyl)aniline.
| Compound Name | 4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-(dimethylaminosulfamoyl)aniline |
|---|---|
| PubChem CID | 68886429 |
| Molecular Formula | C18H22Cl2N4O2S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 4-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)-N-(dimethylaminosulfamoyl)aniline |
| SMILES | CN1Cc2c(Cl)cc(Cl)cc2C(c2ccc(NS(=O)(=O)NN(C)C)cc2)C1 |
| InChI | InChI=1S/C18H22Cl2N4O2S/c1-23(2)22-27(25,26)21-14-6-4-12(5-7-14)16-10-24(3)11-17-15(16)8-13(19)9-18(17)20/h4-9,16,21-22H,10-11H2,1-3H3 |
| InChIKey | VZNJHGVSAULELT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|