C10H17NO4Y — CID 159970528
(1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium (PubChem CID 159970528) has the molecular formula C10H17NO4Y and a molecular weight of 304.16 g/mol. Its IUPAC name is (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium.
| Compound Name | (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium |
|---|---|
| PubChem CID | 159970528 |
| Molecular Formula | C10H17NO4Y |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium |
| SMILES | CNC(=O)C1CC(OC)CC[C@@H]1C(=O)O.[Y] |
| InChI | InChI=1S/C10H17NO4.Y/c1-11-9(12)8-5-6(15-2)3-4-7(8)10(13)14;/h6-8H,3-5H2,1-2H3,(H,11,12)(H,13,14);/t6?,7-,8?;/m0./s1 |
| InChIKey | NAKDIZOGPSGPMU-HKFBNJBWSA-N |
| XLogP | 0.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |