About (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium
(1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium (PubChem CID 159970528) has the molecular formula C10H17NO4Y
and a molecular weight of 304.16 g/mol. Its IUPAC name is (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium.
Molecular Properties
| Compound Name | (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium |
| PubChem CID | 159970528 |
| Molecular Formula | C10H17NO4Y |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium |
| SMILES | CNC(=O)C1CC(OC)CC[C@@H]1C(=O)O.[Y] |
| InChI | InChI=1S/C10H17NO4.Y/c1-11-9(12)8-5-6(15-2)3-4-7(8)10(13)14;/h6-8H,3-5H2,1-2H3,(H,11,12)(H,13,14);/t6?,7-,8?;/m0./s1 |
| InChIKey | NAKDIZOGPSGPMU-HKFBNJBWSA-N |
| XLogP | 0.25 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium?
The IUPAC name of (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium (CID 159970528) is (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium.
What is the SMILES notation for (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium?
The canonical SMILES for (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium is CNC(=O)C1CC(OC)CC[C@@H]1C(=O)O.[Y].
What is the InChIKey of (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium?
The InChIKey is NAKDIZOGPSGPMU-HKFBNJBWSA-N. The full InChI is InChI=1S/C10H17NO4.Y/c1-11-9(12)8-5-6(15-2)3-4-7(8)10(13)14;/h6-8H,3-5H2,1-2H3,(H,11,12)(H,13,14);/t6?,7-,8?;/m0./s1.
What are the key properties of (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium?
(1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium has a molecular weight of 304.16 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-methoxy-2-(methylcarbamoyl)cyclohexane-1-carboxylic acid;yttrium is sourced from PubChem (CID 159970528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).