C9H13F3O3 — CID 149145912
4-methoxy-2-(trifluoromethyl)cyclohexane-1-carboxylic acid (PubChem CID 149145912) has the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. Its IUPAC name is 4-methoxy-2-(trifluoromethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-methoxy-2-(trifluoromethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 149145912 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-methoxy-2-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| SMILES | COC1CCC(C(=O)O)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H13F3O3/c1-15-5-2-3-6(8(13)14)7(4-5)9(10,11)12/h5-7H,2-4H2,1H3,(H,13,14) |
| InChIKey | UGBYQJTZDLTFLA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |