C11H18ClNO3 — CID 124924787
(2R,4S,4aR,6R,8aS)-2-chloro-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylic acid (PubChem CID 124924787) has the molecular formula C11H18ClNO3 and a molecular weight of 247.72 g/mol. Its IUPAC name is (2R,4S,4aR,6R,8aS)-2-chloro-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylic acid.
| Compound Name | (2R,4S,4aR,6R,8aS)-2-chloro-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 124924787 |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (2R,4S,4aR,6R,8aS)-2-chloro-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-4-carboxylic acid |
| SMILES | CO[C@@H]1CC[C@@H]2N[C@H](Cl)C[C@H](C(=O)O)[C@H]2C1 |
| InChI | InChI=1S/C11H18ClNO3/c1-16-6-2-3-9-7(4-6)8(11(14)15)5-10(12)13-9/h6-10,13H,2-5H2,1H3,(H,14,15)/t6-,7-,8+,9+,10+/m1/s1 |
| InChIKey | CWGRCZUHVKLQCS-ZJDVBMNYSA-N |
| XLogP | 1.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|