C6H12NRf2- — CID 159971843
2,3-dimethylbut-3-en-2-ylazanide;bis(rutherfordium) (PubChem CID 159971843) has the molecular formula C6H12NRf2- and a molecular weight of 632.17 g/mol. Its IUPAC name is 2,3-dimethylbut-3-en-2-ylazanide;bis(rutherfordium).
| Compound Name | 2,3-dimethylbut-3-en-2-ylazanide;bis(rutherfordium) |
|---|---|
| PubChem CID | 159971843 |
| Molecular Formula | C6H12NRf2- |
| Molecular Weight | 632.17 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 2,3-dimethylbut-3-en-2-ylazanide;bis(rutherfordium) |
| SMILES | C=C(C)C(C)(C)[NH-].[Rf].[Rf] |
| InChI | InChI=1S/C6H12N.2Rf/c1-5(2)6(3,4)7;;/h7H,1H2,2-4H3;;/q-1;; |
| InChIKey | PQNYSEOQYNSGIG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|