About 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol
1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol (PubChem CID 159977727) has the molecular formula C20H23BrI2O4
and a molecular weight of 661.11 g/mol. Its IUPAC name is 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol.
Molecular Properties
| Compound Name | 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol |
| PubChem CID | 159977727 |
| Molecular Formula | C20H23BrI2O4 |
| Molecular Weight | 661.11 g/mol |
| Exact Mass | 659.89 |
| IUPAC Name | 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol |
| SMILES | BrCc1ccc(I)cc1.Ic1ccc(COC2COC2)cc1.OC1COC1 |
| InChI | InChI=1S/C10H11IO2.C7H6BrI.C3H6O2/c11-9-3-1-8(2-4-9)5-13-10-6-12-7-10;8-5-6-1-3-7(9)4-2-6;4-3-1-5-2-3/h1-4,10H,5-7H2;1-4H,5H2;3-4H,1-2H2 |
| InChIKey | OFJGAEYTFKYXCC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 661.11 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol?
The IUPAC name of 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol (CID 159977727) is 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol.
What is the SMILES notation for 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol?
The canonical SMILES for 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol is BrCc1ccc(I)cc1.Ic1ccc(COC2COC2)cc1.OC1COC1.
What is the InChIKey of 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol?
The InChIKey is OFJGAEYTFKYXCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IO2.C7H6BrI.C3H6O2/c11-9-3-1-8(2-4-9)5-13-10-6-12-7-10;8-5-6-1-3-7(9)4-2-6;4-3-1-5-2-3/h1-4,10H,5-7H2;1-4H,5H2;3-4H,1-2H2.
What are the key properties of 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol?
1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol has a molecular weight of 661.11 g/mol, XLogP of 4.77, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-4-iodobenzene;3-[(4-iodophenyl)methoxy]oxetane;oxetan-3-ol is sourced from PubChem (CID 159977727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).